C28H37N3O3S — CID 141164206
N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]hexanamide (PubChem CID 141164206) has the molecular formula C28H37N3O3S and a molecular weight of 495.69 g/mol. Its IUPAC name is N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]hexanamide.
| Compound Name | N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 141164206 |
| Molecular Formula | C28H37N3O3S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-[[3-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]hexanamide |
| SMILES | CCCCCC(=O)NCc1cccc(-c2ccc3[nH]cc(C4CCN(S(=O)(=O)CC)CC4)c3c2)c1 |
| InChI | InChI=1S/C28H37N3O3S/c1-3-5-6-10-28(32)30-19-21-8-7-9-23(17-21)24-11-12-27-25(18-24)26(20-29-27)22-13-15-31(16-14-22)35(33,34)4-2/h7-9,11-12,17-18,20,22,29H,3-6,10,13-16,19H2,1-2H3,(H,30,32) |
| InChIKey | VZWPSABZYSYSAR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|