C27H35N3O3S — CID 141141048
1-[3-[4-(5-phenyl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]piperidin-4-ol (PubChem CID 141141048) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is 1-[3-[4-(5-phenyl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]piperidin-4-ol.
| Compound Name | 1-[3-[4-(5-phenyl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 141141048 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 1-[3-[4-(5-phenyl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]piperidin-4-ol |
| SMILES | O=S(=O)(CCCN1CCC(O)CC1)N1CCC(c2c[nH]c3ccc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C27H35N3O3S/c31-24-11-14-29(15-12-24)13-4-18-34(32,33)30-16-9-22(10-17-30)26-20-28-27-8-7-23(19-25(26)27)21-5-2-1-3-6-21/h1-3,5-8,19-20,22,24,28,31H,4,9-18H2 |
| InChIKey | CHIRVBVECFBCKK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |