C28H29FN2O3S — CID 141141054
3-[1-[3-(4-fluorophenoxy)propylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole (PubChem CID 141141054) has the molecular formula C28H29FN2O3S and a molecular weight of 492.62 g/mol. Its IUPAC name is 3-[1-[3-(4-fluorophenoxy)propylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole.
| Compound Name | 3-[1-[3-(4-fluorophenoxy)propylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole |
|---|---|
| PubChem CID | 141141054 |
| Molecular Formula | C28H29FN2O3S |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 3-[1-[3-(4-fluorophenoxy)propylsulfonyl]piperidin-4-yl]-5-phenyl-1H-indole |
| SMILES | O=S(=O)(CCCOc1ccc(F)cc1)N1CCC(c2c[nH]c3ccc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C28H29FN2O3S/c29-24-8-10-25(11-9-24)34-17-4-18-35(32,33)31-15-13-22(14-16-31)27-20-30-28-12-7-23(19-26(27)28)21-5-2-1-3-6-21/h1-3,5-12,19-20,22,30H,4,13-18H2 |
| InChIKey | OJSRVRJOVDALQJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|