C24H31N3O3S2 — CID 141141032
4-[3-[4-(5-thiophen-2-yl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]morpholine (PubChem CID 141141032) has the molecular formula C24H31N3O3S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is 4-[3-[4-(5-thiophen-2-yl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]morpholine.
| Compound Name | 4-[3-[4-(5-thiophen-2-yl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]morpholine |
|---|---|
| PubChem CID | 141141032 |
| Molecular Formula | C24H31N3O3S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 4-[3-[4-(5-thiophen-2-yl-1H-indol-3-yl)piperidin-1-yl]sulfonylpropyl]morpholine |
| SMILES | O=S(=O)(CCCN1CCOCC1)N1CCC(c2c[nH]c3ccc(-c4cccs4)cc23)CC1 |
| InChI | InChI=1S/C24H31N3O3S2/c28-32(29,16-2-8-26-11-13-30-14-12-26)27-9-6-19(7-10-27)22-18-25-23-5-4-20(17-21(22)23)24-3-1-15-31-24/h1,3-5,15,17-19,25H,2,6-14,16H2 |
| InChIKey | YPUQMIJOSAUENW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |