C24H33N3O2S2 — CID 141164204
N-[[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-2-yl]methyl]butan-1-amine (PubChem CID 141164204) has the molecular formula C24H33N3O2S2 and a molecular weight of 459.68 g/mol. Its IUPAC name is N-[[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-2-yl]methyl]butan-1-amine.
| Compound Name | N-[[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-2-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 141164204 |
| Molecular Formula | C24H33N3O2S2 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-2-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1ccc(-c2ccc3[nH]cc(C4CCN(S(=O)(=O)CC)CC4)c3c2)s1 |
| InChI | InChI=1S/C24H33N3O2S2/c1-3-5-12-25-16-20-7-9-24(30-20)19-6-8-23-21(15-19)22(17-26-23)18-10-13-27(14-11-18)31(28,29)4-2/h6-9,15,17-18,25-26H,3-5,10-14,16H2,1-2H3 |
| InChIKey | LBEOTECYBTYBJG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|