C26H35N3O2S — CID 141164179
N-ethyl-N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]ethanamine (PubChem CID 141164179) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is N-ethyl-N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]ethanamine.
| Compound Name | N-ethyl-N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 141164179 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | N-ethyl-N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]ethanamine |
| SMILES | CCN(CC)Cc1ccc(-c2ccc3[nH]cc(C4CCN(S(=O)(=O)CC)CC4)c3c2)cc1 |
| InChI | InChI=1S/C26H35N3O2S/c1-4-28(5-2)19-20-7-9-21(10-8-20)23-11-12-26-24(17-23)25(18-27-26)22-13-15-29(16-14-22)32(30,31)6-3/h7-12,17-18,22,27H,4-6,13-16,19H2,1-3H3 |
| InChIKey | UIYJKAIOKUZYKK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |