C26H33N3O2S — CID 141164136
N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]cyclobutanamine (PubChem CID 141164136) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]cyclobutanamine.
| Compound Name | N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]cyclobutanamine |
|---|---|
| PubChem CID | 141164136 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[[4-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]phenyl]methyl]cyclobutanamine |
| SMILES | CCS(=O)(=O)N1CCC(c2c[nH]c3ccc(-c4ccc(CNC5CCC5)cc4)cc23)CC1 |
| InChI | InChI=1S/C26H33N3O2S/c1-2-32(30,31)29-14-12-21(13-15-29)25-18-28-26-11-10-22(16-24(25)26)20-8-6-19(7-9-20)17-27-23-4-3-5-23/h6-11,16,18,21,23,27-28H,2-5,12-15,17H2,1H3 |
| InChIKey | YCVXOVLVSJJCIS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |