C29H39N3O2S — CID 141141031
N-[3-[4-[5-(4-ethylphenyl)-1H-indol-3-yl]piperidin-1-yl]sulfonylpropyl]cyclopentanamine (PubChem CID 141141031) has the molecular formula C29H39N3O2S and a molecular weight of 493.72 g/mol. Its IUPAC name is N-[3-[4-[5-(4-ethylphenyl)-1H-indol-3-yl]piperidin-1-yl]sulfonylpropyl]cyclopentanamine.
| Compound Name | N-[3-[4-[5-(4-ethylphenyl)-1H-indol-3-yl]piperidin-1-yl]sulfonylpropyl]cyclopentanamine |
|---|---|
| PubChem CID | 141141031 |
| Molecular Formula | C29H39N3O2S |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | N-[3-[4-[5-(4-ethylphenyl)-1H-indol-3-yl]piperidin-1-yl]sulfonylpropyl]cyclopentanamine |
| SMILES | CCc1ccc(-c2ccc3[nH]cc(C4CCN(S(=O)(=O)CCCNC5CCCC5)CC4)c3c2)cc1 |
| InChI | InChI=1S/C29H39N3O2S/c1-2-22-8-10-23(11-9-22)25-12-13-29-27(20-25)28(21-31-29)24-14-17-32(18-15-24)35(33,34)19-5-16-30-26-6-3-4-7-26/h8-13,20-21,24,26,30-31H,2-7,14-19H2,1H3 |
| InChIKey | DGGWTHNGJLYNLR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|