C23H34N4O3S — CID 59600658
3-[1-[3-(cyclopentylamino)propylsulfonyl]piperidin-4-yl]-5-methyl-1H-indole-7-carboxamide (PubChem CID 59600658) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is 3-[1-[3-(cyclopentylamino)propylsulfonyl]piperidin-4-yl]-5-methyl-1H-indole-7-carboxamide.
| Compound Name | 3-[1-[3-(cyclopentylamino)propylsulfonyl]piperidin-4-yl]-5-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 59600658 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 3-[1-[3-(cyclopentylamino)propylsulfonyl]piperidin-4-yl]-5-methyl-1H-indole-7-carboxamide |
| SMILES | Cc1cc(C(N)=O)c2[nH]cc(C3CCN(S(=O)(=O)CCCNC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C23H34N4O3S/c1-16-13-19-21(15-26-22(19)20(14-16)23(24)28)17-7-10-27(11-8-17)31(29,30)12-4-9-25-18-5-2-3-6-18/h13-15,17-18,25-26H,2-12H2,1H3,(H2,24,28) |
| InChIKey | BGCIKGGGJIGCPL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|