C21H27N3O2S2 — CID 141164155
1-[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-3-yl]-N-methylmethanamine (PubChem CID 141164155) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 1-[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-3-yl]-N-methylmethanamine.
| Compound Name | 1-[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 141164155 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-[5-[3-(1-ethylsulfonylpiperidin-4-yl)-1H-indol-5-yl]thiophen-3-yl]-N-methylmethanamine |
| SMILES | CCS(=O)(=O)N1CCC(c2c[nH]c3ccc(-c4cc(CNC)cs4)cc23)CC1 |
| InChI | InChI=1S/C21H27N3O2S2/c1-3-28(25,26)24-8-6-16(7-9-24)19-13-23-20-5-4-17(11-18(19)20)21-10-15(12-22-2)14-27-21/h4-5,10-11,13-14,16,22-23H,3,6-9,12H2,1-2H3 |
| InChIKey | SCOZWYXJSFZLMK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |