C17H26ClN3O2S — CID 159347443
3-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-N-sulfanylperoxypropan-1-amine;hydrochloride (PubChem CID 159347443) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is 3-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-N-sulfanylperoxypropan-1-amine;hydrochloride.
| Compound Name | 3-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-N-sulfanylperoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 159347443 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-N-sulfanylperoxypropan-1-amine;hydrochloride |
| SMILES | CN1CCC(c2c[nH]c3ccc(CCCNOOS)cc23)CC1.Cl |
| InChI | InChI=1S/C17H25N3O2S.ClH/c1-20-9-6-14(7-10-20)16-12-18-17-5-4-13(11-15(16)17)3-2-8-19-21-22-23;/h4-5,11-12,14,18-19,23H,2-3,6-10H2,1H3;1H |
| InChIKey | RLIGRYRGVLGMBD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|