C17H26ClN3O2S — CID 19817120
N-[2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethyl]methanesulfonamide;hydrochloride (PubChem CID 19817120) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is N-[2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 19817120 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethyl]methanesulfonamide;hydrochloride |
| SMILES | CN1CCC(c2c[nH]c3ccc(CCNS(C)(=O)=O)cc23)CC1.Cl |
| InChI | InChI=1S/C17H25N3O2S.ClH/c1-20-9-6-14(7-10-20)16-12-18-17-4-3-13(11-15(16)17)5-8-19-23(2,21)22;/h3-4,11-12,14,18-19H,5-10H2,1-2H3;1H |
| InChIKey | DPZFDSZOQWBYFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |