C17H25N3O2S — CID 45040003
N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide (PubChem CID 45040003) has the molecular formula C17H25N3O2S and a molecular weight of 338.49 g/mol. Its IUPAC name is N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide.
| Compound Name | N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 45040003 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide |
| SMILES | [2H]C([2H])([2H])N1CCC(c2c[nH]c3ccc(CCS(=O)(=O)NC)cc23)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-18-23(21,22)10-7-13-3-4-17-15(11-13)16(12-19-17)14-5-8-20(2)9-6-14/h3-4,11-12,14,18-19H,5-10H2,1-2H3/i2D3 |
| InChIKey | AMKVXSZCKVJAGH-BMSJAHLVSA-N |
| XLogP | 2.07 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |