About 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide
2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide (PubChem CID 85260849) has the molecular formula C18H28N3O2S+
and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide.
Molecular Properties
| Compound Name | 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide |
| PubChem CID | 85260849 |
| Molecular Formula | C18H28N3O2S+ |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCc1ccc2[nH]cc(C3CC[N+](C)(C)CC3)c2c1 |
| InChI | InChI=1S/C18H28N3O2S/c1-19-24(22,23)11-8-14-4-5-18-16(12-14)17(13-20-18)15-6-9-21(2,3)10-7-15/h4-5,12-13,15,19-20H,6-11H2,1-3H3/q+1 |
| InChIKey | FWLLFQPKDOKBTN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide?
The IUPAC name of 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide (CID 85260849) is 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide.
What is the SMILES notation for 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide?
The canonical SMILES for 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide is CNS(=O)(=O)CCc1ccc2[nH]cc(C3CC[N+](C)(C)CC3)c2c1.
What is the InChIKey of 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide?
The InChIKey is FWLLFQPKDOKBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N3O2S/c1-19-24(22,23)11-8-14-4-5-18-16(12-14)17(13-20-18)15-6-9-21(2,3)10-7-15/h4-5,12-13,15,19-20H,6-11H2,1-3H3/q+1.
What are the key properties of 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide?
2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide has a molecular weight of 350.51 g/mol, XLogP of 2.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1H-indol-5-yl]-N-methylethanesulfonamide is sourced from PubChem (CID 85260849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).