C24H29ClN2O2 — CID 69172181
(E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(furan-3-yl)prop-2-enamide (PubChem CID 69172181) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is (E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(furan-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(furan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 69172181 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(furan-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccoc1)NC1CCC(CN2CCC(c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C24H29ClN2O2/c25-22-5-3-20(4-6-22)21-9-12-27(13-10-21)16-19-1-7-23(15-19)26-24(28)8-2-18-11-14-29-17-18/h2-6,8,11,14,17,19,21,23H,1,7,9-10,12-13,15-16H2,(H,26,28)/b8-2+ |
| InChIKey | NNHUUAYLBPVADM-KRXBUXKQSA-N |
| XLogP | 5.11 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|