C16H20FN3O4 — CID 68959142
(3R)-3-[[5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid (PubChem CID 68959142) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is (3R)-3-[[5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[[5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68959142 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (3R)-3-[[5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C(F)=Cc1ccc(N[C@@H]2CCCN(C(=O)O)C2)nc1 |
| InChI | InChI=1S/C16H20FN3O4/c1-2-24-15(21)13(17)8-11-5-6-14(18-9-11)19-12-4-3-7-20(10-12)16(22)23/h5-6,8-9,12H,2-4,7,10H2,1H3,(H,18,19)(H,22,23)/t12-/m1/s1 |
| InChIKey | HHHIGCUQVGHIGX-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|