C21H30FN3O2 — CID 140500646
ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpiperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate (PubChem CID 140500646) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpiperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate.
| Compound Name | ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpiperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 140500646 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpiperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/c1ccc(N[C@@H]2CCCN(C3CCCCC3)C2)nc1 |
| InChI | InChI=1S/C21H30FN3O2/c1-2-27-21(26)19(22)13-16-10-11-20(23-14-16)24-17-7-6-12-25(15-17)18-8-4-3-5-9-18/h10-11,13-14,17-18H,2-9,12,15H2,1H3,(H,23,24)/b19-13-/t17-/m1/s1 |
| InChIKey | LBXZASHLWOSKPQ-MCRQTXEHSA-N |
| XLogP | 4.16 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|