C19H30Cl2N4O2 — CID 87636226
(E)-3-[6-[[(3R)-1-cycloheptylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride (PubChem CID 87636226) has the molecular formula C19H30Cl2N4O2 and a molecular weight of 417.38 g/mol. Its IUPAC name is (E)-3-[6-[[(3R)-1-cycloheptylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride.
| Compound Name | (E)-3-[6-[[(3R)-1-cycloheptylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 87636226 |
| Molecular Formula | C19H30Cl2N4O2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (E)-3-[6-[[(3R)-1-cycloheptylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(/C=C/c1ccc(N[C@@H]2CCN(C3CCCCCC3)C2)nc1)NO |
| InChI | InChI=1S/C19H28N4O2.2ClH/c24-19(22-25)10-8-15-7-9-18(20-13-15)21-16-11-12-23(14-16)17-5-3-1-2-4-6-17;;/h7-10,13,16-17,25H,1-6,11-12,14H2,(H,20,21)(H,22,24);2*1H/b10-8+;;/t16-;;/m1../s1 |
| InChIKey | IGWJJGLWOJQEBP-IPPLNXPOSA-N |
| XLogP | 3.65 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|