C18H27Cl2FN4O2 — CID 173125089
3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide;dihydrochloride (PubChem CID 173125089) has the molecular formula C18H27Cl2FN4O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide;dihydrochloride.
| Compound Name | 3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 173125089 |
| Molecular Formula | C18H27Cl2FN4O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NO)C(F)=Cc1ccc(N[C@@H]2CCN(C3CCCCC3)C2)nc1 |
| InChI | InChI=1S/C18H25FN4O2.2ClH/c19-16(18(24)22-25)10-13-6-7-17(20-11-13)21-14-8-9-23(12-14)15-4-2-1-3-5-15;;/h6-7,10-11,14-15,25H,1-5,8-9,12H2,(H,20,21)(H,22,24);2*1H/t14-;;/m1../s1 |
| InChIKey | QOHCYZQNCCCXQJ-FMOMHUKBSA-N |
| XLogP | 3.56 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|