C22H36Cl2N4O2 — CID 87637327
(E)-N-hydroxy-3-[6-[[(3R)-1-(3,3,5,5-tetramethylcyclohexyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enamide;dihydrochloride (PubChem CID 87637327) has the molecular formula C22H36Cl2N4O2 and a molecular weight of 459.46 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[6-[[(3R)-1-(3,3,5,5-tetramethylcyclohexyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enamide;dihydrochloride.
| Compound Name | (E)-N-hydroxy-3-[6-[[(3R)-1-(3,3,5,5-tetramethylcyclohexyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 87637327 |
| Molecular Formula | C22H36Cl2N4O2 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (E)-N-hydroxy-3-[6-[[(3R)-1-(3,3,5,5-tetramethylcyclohexyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enamide;dihydrochloride |
| SMILES | CC1(C)CC(N2CC[C@@H](Nc3ccc(/C=C/C(=O)NO)cn3)C2)CC(C)(C)C1.Cl.Cl |
| InChI | InChI=1S/C22H34N4O2.2ClH/c1-21(2)11-18(12-22(3,4)15-21)26-10-9-17(14-26)24-19-7-5-16(13-23-19)6-8-20(27)25-28;;/h5-8,13,17-18,28H,9-12,14-15H2,1-4H3,(H,23,24)(H,25,27);2*1H/b8-6+;;/t17-;;/m1../s1 |
| InChIKey | WPTUSSGHRVEZHI-CZSURGOCSA-N |
| XLogP | 4.53 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|