C20H28FN3O2 — CID 140500623
ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate (PubChem CID 140500623) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate.
| Compound Name | ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 140500623 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethyl (Z)-3-[6-[[(3R)-1-cyclohexylpyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/c1ccc(N[C@@H]2CCN(C3CCCCC3)C2)nc1 |
| InChI | InChI=1S/C20H28FN3O2/c1-2-26-20(25)18(21)12-15-8-9-19(22-13-15)23-16-10-11-24(14-16)17-6-4-3-5-7-17/h8-9,12-13,16-17H,2-7,10-11,14H2,1H3,(H,22,23)/b18-12-/t16-/m1/s1 |
| InChIKey | VKJUCSVEEQNQEZ-UWCCDQBKSA-N |
| XLogP | 3.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|