C20H28FN3O4 — CID 140500493
tert-butyl (3R)-3-[[5-[(Z)-3-ethoxy-2-fluoro-3-oxoprop-1-enyl]-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 140500493) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-[(Z)-3-ethoxy-2-fluoro-3-oxoprop-1-enyl]-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-[(Z)-3-ethoxy-2-fluoro-3-oxoprop-1-enyl]-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140500493 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl (3R)-3-[[5-[(Z)-3-ethoxy-2-fluoro-3-oxoprop-1-enyl]-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)/C(F)=C/c1ccc(N[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 |
| InChI | InChI=1S/C20H28FN3O4/c1-5-27-18(25)16(21)11-14-8-9-17(22-12-14)23-15-7-6-10-24(13-15)19(26)28-20(2,3)4/h8-9,11-12,15H,5-7,10,13H2,1-4H3,(H,22,23)/b16-11-/t15-/m1/s1 |
| InChIKey | UYNFSUXHFBVZKB-DFSFMLJYSA-N |
| XLogP | 3.77 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|