C16H19ClFN3O4 — CID 68966943
(3R)-3-[[3-chloro-5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid (PubChem CID 68966943) has the molecular formula C16H19ClFN3O4 and a molecular weight of 371.80 g/mol. Its IUPAC name is (3R)-3-[[3-chloro-5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[[3-chloro-5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68966943 |
| Molecular Formula | C16H19ClFN3O4 |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (3R)-3-[[3-chloro-5-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2-pyridinyl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C(F)=Cc1cnc(N[C@@H]2CCCN(C(=O)O)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H19ClFN3O4/c1-2-25-15(22)13(18)7-10-6-12(17)14(19-8-10)20-11-4-3-5-21(9-11)16(23)24/h6-8,11H,2-5,9H2,1H3,(H,19,20)(H,23,24)/t11-/m1/s1 |
| InChIKey | HGTWIFGUAPXGCJ-LLVKDONJSA-N |
| XLogP | 3.16 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|