C13H15ClFN3O2 — CID 68962633
(Z)-3-[5-chloro-6-[[(3R)-piperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoic acid (PubChem CID 68962633) has the molecular formula C13H15ClFN3O2 and a molecular weight of 299.73 g/mol. Its IUPAC name is (Z)-3-[5-chloro-6-[[(3R)-piperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[5-chloro-6-[[(3R)-piperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 68962633 |
| Molecular Formula | C13H15ClFN3O2 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (Z)-3-[5-chloro-6-[[(3R)-piperidin-3-yl]amino]-3-pyridinyl]-2-fluoroprop-2-enoic acid |
| SMILES | O=C(O)/C(F)=C/c1cnc(N[C@@H]2CCCNC2)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFN3O2/c14-10-4-8(5-11(15)13(19)20)6-17-12(10)18-9-2-1-3-16-7-9/h4-6,9,16H,1-3,7H2,(H,17,18)(H,19,20)/b11-5-/t9-/m1/s1 |
| InChIKey | XGKRCDCQNMLSRY-QQCYMQAYSA-N |
| XLogP | 2.29 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|