C19H20ClFN4O2 — CID 91178498
3-[6-[[(3R)-1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide (PubChem CID 91178498) has the molecular formula C19H20ClFN4O2 and a molecular weight of 390.85 g/mol. Its IUPAC name is 3-[6-[[(3R)-1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide.
| Compound Name | 3-[6-[[(3R)-1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 91178498 |
| Molecular Formula | C19H20ClFN4O2 |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-[6-[[(3R)-1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-2-fluoro-N-hydroxyprop-2-enamide |
| SMILES | O=C(NO)C(F)=Cc1ccc(N[C@@H]2CCN(Cc3ccc(Cl)cc3)C2)nc1 |
| InChI | InChI=1S/C19H20ClFN4O2/c20-15-4-1-13(2-5-15)11-25-8-7-16(12-25)23-18-6-3-14(10-22-18)9-17(21)19(26)24-27/h1-6,9-10,16,27H,7-8,11-12H2,(H,22,23)(H,24,26)/t16-/m1/s1 |
| InChIKey | PKKNVXDNQFXLOE-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|