C17H19NO5S — CID 67526445
ethyl (E)-3-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 67526445) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl (E)-3-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67526445 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | ethyl (E)-3-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1csc(-c2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C17H19NO5S/c1-5-23-15(19)7-6-12-10-24-17(18-12)11-8-13(20-2)16(22-4)14(9-11)21-3/h6-10H,5H2,1-4H3/b7-6+ |
| InChIKey | VCJNZIOHPADOLC-VOTSOKGWSA-N |
| XLogP | 3.41 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|