C12H10N2O2S — CID 173392183
3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoic acid (PubChem CID 173392183) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoic acid.
| Compound Name | 3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 173392183 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H10N2O2S/c15-11(16)7-6-10-8-17-12(14-10)13-9-4-2-1-3-5-9/h1-8H,(H,13,14)(H,15,16) |
| InChIKey | NHTVYYRNZPQHHY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|