C10H8N2O2S — CID 144776560
2-(4-hydroxyanilino)-1,3-thiazole-4-carbaldehyde (PubChem CID 144776560) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-(4-hydroxyanilino)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(4-hydroxyanilino)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 144776560 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-(4-hydroxyanilino)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H8N2O2S/c13-5-8-6-15-10(12-8)11-7-1-3-9(14)4-2-7/h1-6,14H,(H,11,12) |
| InChIKey | AWTVACTXQDRBSF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|