C11H10N2O2S — CID 176659494
2-[4-(methoxyamino)phenyl]-1,3-thiazole-4-carbaldehyde (PubChem CID 176659494) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-[4-(methoxyamino)phenyl]-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-[4-(methoxyamino)phenyl]-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 176659494 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-[4-(methoxyamino)phenyl]-1,3-thiazole-4-carbaldehyde |
| SMILES | CONc1ccc(-c2nc(C=O)cs2)cc1 |
| InChI | InChI=1S/C11H10N2O2S/c1-15-13-9-4-2-8(3-5-9)11-12-10(6-14)7-16-11/h2-7,13H,1H3 |
| InChIKey | LMDZRTABCGSLJM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|