C9H9N3O2S — CID 155782839
2-[1-(methoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbaldehyde (PubChem CID 155782839) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is 2-[1-(methoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-[1-(methoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 155782839 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 2-[1-(methoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbaldehyde |
| SMILES | COCn1cc(-c2nc(C=O)cs2)cn1 |
| InChI | InChI=1S/C9H9N3O2S/c1-14-6-12-3-7(2-10-12)9-11-8(4-13)5-15-9/h2-5H,6H2,1H3 |
| InChIKey | QMLXVPNPABIERK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|