C13H14N4O3S — CID 164917586
[4-(4-formyl-1,3-thiazol-2-yl)pyrazol-1-yl]methyl pyrrolidine-2-carboxylate (PubChem CID 164917586) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is [4-(4-formyl-1,3-thiazol-2-yl)pyrazol-1-yl]methyl pyrrolidine-2-carboxylate.
| Compound Name | [4-(4-formyl-1,3-thiazol-2-yl)pyrazol-1-yl]methyl pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 164917586 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [4-(4-formyl-1,3-thiazol-2-yl)pyrazol-1-yl]methyl pyrrolidine-2-carboxylate |
| SMILES | O=Cc1csc(-c2cnn(COC(=O)C3CCCN3)c2)n1 |
| InChI | InChI=1S/C13H14N4O3S/c18-6-10-7-21-12(16-10)9-4-15-17(5-9)8-20-13(19)11-2-1-3-14-11/h4-7,11,14H,1-3,8H2 |
| InChIKey | WKCVXOWGXMNSPU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|