C9H9N3OS — CID 103570317
2-(1-ethylpyrazol-4-yl)-1,3-thiazole-4-carbaldehyde (PubChem CID 103570317) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 103570317 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-1,3-thiazole-4-carbaldehyde |
| SMILES | CCn1cc(-c2nc(C=O)cs2)cn1 |
| InChI | InChI=1S/C9H9N3OS/c1-2-12-4-7(3-10-12)9-11-8(5-13)6-14-9/h3-6H,2H2,1H3 |
| InChIKey | IBODTZKZVWVGDZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|