4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid

C11H13N3O2S — CID 103570070

IUPAC4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(-c2cnn(CC)c2)sc1C(=O)O
InChIInChI=1S/C11H13N3O2S/c1-3-8-9(11(15)16)17-10(13-8)7-5-12-14(4-2)6-7/h5-6H,3-4H2,1-2H3,(H,15,16)
InChIKeyPSGDQKCQIWZWAD-UHFFFAOYSA-N
MW251.31 g/mol
LogP2.29
Rot. Bonds4

About 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid

4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 103570070) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid
PubChem CID103570070
Molecular FormulaC11H13N3O2S
Molecular Weight251.31 g/mol
Exact Mass251.07
IUPAC Name4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(-c2cnn(CC)c2)sc1C(=O)O
InChIInChI=1S/C11H13N3O2S/c1-3-8-9(11(15)16)17-10(13-8)7-5-12-14(4-2)6-7/h5-6H,3-4H2,1-2H3,(H,15,16)
InChIKeyPSGDQKCQIWZWAD-UHFFFAOYSA-N
XLogP2.29
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.31
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid (CID 103570070) is 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid is CCc1nc(-c2cnn(CC)c2)sc1C(=O)O.
What is the InChIKey of 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is PSGDQKCQIWZWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S/c1-3-8-9(11(15)16)17-10(13-8)7-5-12-14(4-2)6-7/h5-6H,3-4H2,1-2H3,(H,15,16).
What are the key properties of 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid?
4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 251.31 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(1-ethylpyrazol-4-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 103570070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).