C12H8F3NO2S — CID 107935411
4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 107935411) has the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. Its IUPAC name is 4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107935411 |
| Molecular Formula | C12H8F3NO2S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1nc(-c2ccc(F)c(F)c2F)sc1C(=O)O |
| InChI | InChI=1S/C12H8F3NO2S/c1-2-7-10(12(17)18)19-11(16-7)5-3-4-6(13)9(15)8(5)14/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | NQMMPKSZQLQTQY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|