C15H15F3N2S — CID 107935527
N-[[4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methyl]cyclopropanamine (PubChem CID 107935527) has the molecular formula C15H15F3N2S and a molecular weight of 312.36 g/mol. Its IUPAC name is N-[[4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107935527 |
| Molecular Formula | C15H15F3N2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[[4-ethyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methyl]cyclopropanamine |
| SMILES | CCc1nc(-c2ccc(F)c(F)c2F)sc1CNC1CC1 |
| InChI | InChI=1S/C15H15F3N2S/c1-2-11-12(7-19-8-3-4-8)21-15(20-11)9-5-6-10(16)14(18)13(9)17/h5-6,8,19H,2-4,7H2,1H3 |
| InChIKey | MBUFGCZVIIHWJV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|