C14H12BrF2NO2S — CID 107537468
2-(2-bromo-3,4-difluorophenyl)-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 107537468) has the molecular formula C14H12BrF2NO2S and a molecular weight of 376.22 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107537468 |
| Molecular Formula | C14H12BrF2NO2S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)Cc1nc(-c2ccc(F)c(F)c2Br)sc1C(=O)O |
| InChI | InChI=1S/C14H12BrF2NO2S/c1-6(2)5-9-12(14(19)20)21-13(18-9)7-3-4-8(16)11(17)10(7)15/h3-4,6H,5H2,1-2H3,(H,19,20) |
| InChIKey | LISBWDDJWFZEBN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|