C12H10F2N2O — CID 172909498
2-(1-ethylpyrazol-4-yl)-4,5-difluorobenzaldehyde (PubChem CID 172909498) has the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-4,5-difluorobenzaldehyde.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-4,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 172909498 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-4,5-difluorobenzaldehyde |
| SMILES | CCn1cc(-c2cc(F)c(F)cc2C=O)cn1 |
| InChI | InChI=1S/C12H10F2N2O/c1-2-16-6-9(5-15-16)10-4-12(14)11(13)3-8(10)7-17/h3-7H,2H2,1H3 |
| InChIKey | ISJMFFNKVRVLQA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|