About 2-anilino-1,3-thiazole-4-carbaldehyde
2-anilino-1,3-thiazole-4-carbaldehyde (PubChem CID 15053570) has the molecular formula C10H8N2OS
and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-anilino-1,3-thiazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-anilino-1,3-thiazole-4-carbaldehyde |
| PubChem CID | 15053570 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-anilino-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C10H8N2OS/c13-6-9-7-14-10(12-9)11-8-4-2-1-3-5-8/h1-7H,(H,11,12) |
| InChIKey | NOSAHOXGZGOQDO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-anilino-1,3-thiazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-1,3-thiazole-4-carbaldehyde?
The IUPAC name of 2-anilino-1,3-thiazole-4-carbaldehyde (CID 15053570) is 2-anilino-1,3-thiazole-4-carbaldehyde.
What is the SMILES notation for 2-anilino-1,3-thiazole-4-carbaldehyde?
The canonical SMILES for 2-anilino-1,3-thiazole-4-carbaldehyde is O=Cc1csc(Nc2ccccc2)n1.
What is the InChIKey of 2-anilino-1,3-thiazole-4-carbaldehyde?
The InChIKey is NOSAHOXGZGOQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2OS/c13-6-9-7-14-10(12-9)11-8-4-2-1-3-5-8/h1-7H,(H,11,12).
What are the key properties of 2-anilino-1,3-thiazole-4-carbaldehyde?
2-anilino-1,3-thiazole-4-carbaldehyde has a molecular weight of 204.25 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-1,3-thiazole-4-carbaldehyde is sourced from PubChem (CID 15053570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).