C13H9ClN2S2 — CID 175982198
4-(4-chlorothiophen-2-yl)-N-phenyl-1,3-thiazol-2-amine (PubChem CID 175982198) has the molecular formula C13H9ClN2S2 and a molecular weight of 292.82 g/mol. Its IUPAC name is 4-(4-chlorothiophen-2-yl)-N-phenyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorothiophen-2-yl)-N-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 175982198 |
| Molecular Formula | C13H9ClN2S2 |
| Molecular Weight | 292.82 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 4-(4-chlorothiophen-2-yl)-N-phenyl-1,3-thiazol-2-amine |
| SMILES | Clc1csc(-c2csc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C13H9ClN2S2/c14-9-6-12(17-7-9)11-8-18-13(16-11)15-10-4-2-1-3-5-10/h1-8H,(H,15,16) |
| InChIKey | WWIYCKGLFRCSNA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |