C13H8ClN3O2S2 — CID 10688355
N-(4-chlorophenyl)-4-(5-nitrothiophen-2-yl)-1,3-thiazol-2-amine (PubChem CID 10688355) has the molecular formula C13H8ClN3O2S2 and a molecular weight of 337.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(5-nitrothiophen-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-chlorophenyl)-4-(5-nitrothiophen-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10688355 |
| Molecular Formula | C13H8ClN3O2S2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | N-(4-chlorophenyl)-4-(5-nitrothiophen-2-yl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)s1 |
| InChI | InChI=1S/C13H8ClN3O2S2/c14-8-1-3-9(4-2-8)15-13-16-10(7-20-13)11-5-6-12(21-11)17(18)19/h1-7H,(H,15,16) |
| InChIKey | AMIRGUVULTXOPX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|