C15H9Cl2N3O2S — CID 1340336
4-(2,4-dichlorophenyl)-N-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 1340336) has the molecular formula C15H9Cl2N3O2S and a molecular weight of 366.23 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(3-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(3-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1340336 |
| Molecular Formula | C15H9Cl2N3O2S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(Nc2nc(-c3ccc(Cl)cc3Cl)cs2)c1 |
| InChI | InChI=1S/C15H9Cl2N3O2S/c16-9-4-5-12(13(17)6-9)14-8-23-15(19-14)18-10-2-1-3-11(7-10)20(21)22/h1-8H,(H,18,19) |
| InChIKey | QENHGWHFXRVNSH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|