C15H9ClN4O4S — CID 57406324
N-(2-chloro-4-nitrophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 57406324) has the molecular formula C15H9ClN4O4S and a molecular weight of 376.78 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloro-4-nitrophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 57406324 |
| Molecular Formula | C15H9ClN4O4S |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(Nc3ccc([N+](=O)[O-])cc3Cl)n2)c1 |
| InChI | InChI=1S/C15H9ClN4O4S/c16-12-7-11(20(23)24)4-5-13(12)17-15-18-14(8-25-15)9-2-1-3-10(6-9)19(21)22/h1-8H,(H,17,18) |
| InChIKey | AFLUEEDHCZVRSK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|