C17H9F3N4O2S — CID 57406323
4-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 57406323) has the molecular formula C17H9F3N4O2S and a molecular weight of 390.35 g/mol. Its IUPAC name is 4-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 57406323 |
| Molecular Formula | C17H9F3N4O2S |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 4-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H9F3N4O2S/c18-17(19,20)14-7-12(5-4-11(14)8-21)22-16-23-15(9-27-16)10-2-1-3-13(6-10)24(25)26/h1-7,9H,(H,22,23) |
| InChIKey | ZNSAKCJBBXJDOQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|