C17H13F3N3OS+ — CID 89283179
methyl-oxo-[3-[2-[2-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]azanium (PubChem CID 89283179) has the molecular formula C17H13F3N3OS+ and a molecular weight of 364.37 g/mol. Its IUPAC name is methyl-oxo-[3-[2-[2-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]azanium.
| Compound Name | methyl-oxo-[3-[2-[2-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]azanium |
|---|---|
| PubChem CID | 89283179 |
| Molecular Formula | C17H13F3N3OS+ |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | methyl-oxo-[3-[2-[2-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]azanium |
| SMILES | C[N+](=O)c1cccc(-c2csc(Nc3ccccc3C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C17H13F3N3OS/c1-23(24)12-6-4-5-11(9-12)15-10-25-16(22-15)21-14-8-3-2-7-13(14)17(18,19)20/h2-10H,1H3,(H,21,22)/q+1 |
| InChIKey | VNMQRQXEOHGYLQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 45.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|