C16H13FN2S — CID 157269328
N-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 157269328) has the molecular formula C16H13FN2S and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 157269328 |
| Molecular Formula | C16H13FN2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cccc(-c2csc(Nc3ccccc3F)n2)c1 |
| InChI | InChI=1S/C16H13FN2S/c1-11-5-4-6-12(9-11)15-10-20-16(19-15)18-14-8-3-2-7-13(14)17/h2-10H,1H3,(H,18,19) |
| InChIKey | LMKQSNYIVWRLEL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |