C16H11Cl2FN2S — CID 10861139
4-(2,4-dichloro-5-fluorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 10861139) has the molecular formula C16H11Cl2FN2S and a molecular weight of 353.25 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-fluorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichloro-5-fluorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10861139 |
| Molecular Formula | C16H11Cl2FN2S |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 4-(2,4-dichloro-5-fluorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccccc1Nc1nc(-c2cc(F)c(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C16H11Cl2FN2S/c1-9-4-2-3-5-14(9)20-16-21-15(8-22-16)10-6-13(19)12(18)7-11(10)17/h2-8H,1H3,(H,20,21) |
| InChIKey | FBJHNCFLHLTAMZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|