C15H7BrCl3FN2S — CID 11134182
N-(4-bromo-3-chlorophenyl)-4-(2,4-dichloro-5-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 11134182) has the molecular formula C15H7BrCl3FN2S and a molecular weight of 452.56 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-4-(2,4-dichloro-5-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-bromo-3-chlorophenyl)-4-(2,4-dichloro-5-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 11134182 |
| Molecular Formula | C15H7BrCl3FN2S |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 449.86 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-4-(2,4-dichloro-5-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Fc1cc(-c2csc(Nc3ccc(Br)c(Cl)c3)n2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H7BrCl3FN2S/c16-9-2-1-7(3-11(9)18)21-15-22-14(6-23-15)8-4-13(20)12(19)5-10(8)17/h1-6H,(H,21,22) |
| InChIKey | NHBSLLCZSPDFSM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|