C19H20N2S — CID 23861845
4-(2,5-dimethylphenyl)-N-(2-ethylphenyl)-1,3-thiazol-2-amine (PubChem CID 23861845) has the molecular formula C19H20N2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N-(2-ethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,5-dimethylphenyl)-N-(2-ethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 23861845 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N-(2-ethylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCc1ccccc1Nc1nc(-c2cc(C)ccc2C)cs1 |
| InChI | InChI=1S/C19H20N2S/c1-4-15-7-5-6-8-17(15)20-19-21-18(12-22-19)16-11-13(2)9-10-14(16)3/h5-12H,4H2,1-3H3,(H,20,21) |
| InChIKey | OSYRPGAKAMRZGG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |