C17H16N2OS3 — CID 86584791
O-methyl 5-methyl-4-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]thiophene-2-carbothioate (PubChem CID 86584791) has the molecular formula C17H16N2OS3 and a molecular weight of 360.53 g/mol. Its IUPAC name is O-methyl 5-methyl-4-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]thiophene-2-carbothioate.
| Compound Name | O-methyl 5-methyl-4-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]thiophene-2-carbothioate |
|---|---|
| PubChem CID | 86584791 |
| Molecular Formula | C17H16N2OS3 |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | O-methyl 5-methyl-4-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]thiophene-2-carbothioate |
| SMILES | COC(=S)c1cc(Nc2nc(-c3cccc(C)c3)cs2)c(C)s1 |
| InChI | InChI=1S/C17H16N2OS3/c1-10-5-4-6-12(7-10)14-9-22-17(19-14)18-13-8-15(16(21)20-3)23-11(13)2/h4-9H,1-3H3,(H,18,19) |
| InChIKey | YEXXEDBWDKHRMB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|