C23H18Br2N2OS3 — CID 86758684
O-methyl 4-[2-[(7-bromo-9H-fluoren-2-yl)amino]-1,3-thiazol-4-yl]-5-methylthiophene-2-carbothioate;hydrobromide (PubChem CID 86758684) has the molecular formula C23H18Br2N2OS3 and a molecular weight of 594.42 g/mol. Its IUPAC name is O-methyl 4-[2-[(7-bromo-9H-fluoren-2-yl)amino]-1,3-thiazol-4-yl]-5-methylthiophene-2-carbothioate;hydrobromide.
| Compound Name | O-methyl 4-[2-[(7-bromo-9H-fluoren-2-yl)amino]-1,3-thiazol-4-yl]-5-methylthiophene-2-carbothioate;hydrobromide |
|---|---|
| PubChem CID | 86758684 |
| Molecular Formula | C23H18Br2N2OS3 |
| Molecular Weight | 594.42 g/mol |
| Exact Mass | 591.89 |
| IUPAC Name | O-methyl 4-[2-[(7-bromo-9H-fluoren-2-yl)amino]-1,3-thiazol-4-yl]-5-methylthiophene-2-carbothioate;hydrobromide |
| SMILES | Br.COC(=S)c1cc(-c2csc(Nc3ccc4c(c3)Cc3cc(Br)ccc3-4)n2)c(C)s1 |
| InChI | InChI=1S/C23H17BrN2OS3.BrH/c1-12-19(10-21(30-12)22(28)27-2)20-11-29-23(26-20)25-16-4-6-18-14(9-16)7-13-8-15(24)3-5-17(13)18;/h3-6,8-11H,7H2,1-2H3,(H,25,26);1H |
| InChIKey | PVRUZDPMCQZNRI-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.42 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|